C12H19N3S — CID 139762259
N'-[3-(aminomethyl)phenyl]-2-methylsulfanylbutanimidamide (PubChem CID 139762259) has the molecular formula C12H19N3S and a molecular weight of 237.37 g/mol. Its IUPAC name is N'-[3-(aminomethyl)phenyl]-2-methylsulfanylbutanimidamide.
| Compound Name | N'-[3-(aminomethyl)phenyl]-2-methylsulfanylbutanimidamide |
|---|---|
| PubChem CID | 139762259 |
| Molecular Formula | C12H19N3S |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | N'-[3-(aminomethyl)phenyl]-2-methylsulfanylbutanimidamide |
| SMILES | CCC(SC)/C(N)=N/c1cccc(CN)c1 |
| InChI | InChI=1S/C12H19N3S/c1-3-11(16-2)12(14)15-10-6-4-5-9(7-10)8-13/h4-7,11H,3,8,13H2,1-2H3,(H2,14,15) |
| InChIKey | YWVPFCSUEVGUND-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|