C11H19Cl2N3Sn — CID 160823981
[N'-[3-(aminomethyl)phenyl]carbamimidoyl]-propyltin;dihydrochloride (PubChem CID 160823981) has the molecular formula C11H19Cl2N3Sn and a molecular weight of 382.91 g/mol. Its IUPAC name is [N'-[3-(aminomethyl)phenyl]carbamimidoyl]-propyltin;dihydrochloride.
| Compound Name | [N'-[3-(aminomethyl)phenyl]carbamimidoyl]-propyltin;dihydrochloride |
|---|---|
| PubChem CID | 160823981 |
| Molecular Formula | C11H19Cl2N3Sn |
| Molecular Weight | 382.91 g/mol |
| Exact Mass | 383.00 |
| IUPAC Name | [N'-[3-(aminomethyl)phenyl]carbamimidoyl]-propyltin;dihydrochloride |
| SMILES | CCC[Sn]/C(N)=N\c1cccc(CN)c1.Cl.Cl |
| InChI | InChI=1S/C8H10N3.C3H7.2ClH.Sn/c9-5-7-2-1-3-8(4-7)11-6-10;1-3-2;;;/h1-4H,5,9H2,(H2,10,11);1,3H2,2H3;2*1H; |
| InChIKey | ACSCZOFPFVNRJH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.91 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|