C15H14BrNO4 — CID 139762771
methyl 2-benzamido-3-(5-bromofuran-2-yl)propanoate (PubChem CID 139762771) has the molecular formula C15H14BrNO4 and a molecular weight of 352.18 g/mol. Its IUPAC name is methyl 2-benzamido-3-(5-bromofuran-2-yl)propanoate.
| Compound Name | methyl 2-benzamido-3-(5-bromofuran-2-yl)propanoate |
|---|---|
| PubChem CID | 139762771 |
| Molecular Formula | C15H14BrNO4 |
| Molecular Weight | 352.18 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | methyl 2-benzamido-3-(5-bromofuran-2-yl)propanoate |
| SMILES | COC(=O)C(Cc1ccc(Br)o1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C15H14BrNO4/c1-20-15(19)12(9-11-7-8-13(16)21-11)17-14(18)10-5-3-2-4-6-10/h2-8,12H,9H2,1H3,(H,17,18) |
| InChIKey | DXQPSLIBMLAHSK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.18 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |