C17H18BrNO5 — CID 142141670
methyl (2S)-3-(5-bromofuran-2-yl)-2-[(2-oxo-2-phenylmethoxyethyl)amino]propanoate (PubChem CID 142141670) has the molecular formula C17H18BrNO5 and a molecular weight of 396.24 g/mol. Its IUPAC name is methyl (2S)-3-(5-bromofuran-2-yl)-2-[(2-oxo-2-phenylmethoxyethyl)amino]propanoate.
| Compound Name | methyl (2S)-3-(5-bromofuran-2-yl)-2-[(2-oxo-2-phenylmethoxyethyl)amino]propanoate |
|---|---|
| PubChem CID | 142141670 |
| Molecular Formula | C17H18BrNO5 |
| Molecular Weight | 396.24 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | methyl (2S)-3-(5-bromofuran-2-yl)-2-[(2-oxo-2-phenylmethoxyethyl)amino]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(Br)o1)NCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H18BrNO5/c1-22-17(21)14(9-13-7-8-15(18)24-13)19-10-16(20)23-11-12-5-3-2-4-6-12/h2-8,14,19H,9-11H2,1H3/t14-/m0/s1 |
| InChIKey | QTVUNFJMOZUZSB-AWEZNQCLSA-N |
| XLogP | 2.46 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.24 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |