C17H28O5 — CID 139765480
methyl 3-oxo-2-(9-pentyl-1,4-dioxaspiro[4.4]nonan-8-yl)butanoate (PubChem CID 139765480) has the molecular formula C17H28O5 and a molecular weight of 312.41 g/mol. Its IUPAC name is methyl 3-oxo-2-(9-pentyl-1,4-dioxaspiro[4.4]nonan-8-yl)butanoate.
| Compound Name | methyl 3-oxo-2-(9-pentyl-1,4-dioxaspiro[4.4]nonan-8-yl)butanoate |
|---|---|
| PubChem CID | 139765480 |
| Molecular Formula | C17H28O5 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | methyl 3-oxo-2-(9-pentyl-1,4-dioxaspiro[4.4]nonan-8-yl)butanoate |
| SMILES | CCCCCC1C(C(C(C)=O)C(=O)OC)CCC12OCCO2 |
| InChI | InChI=1S/C17H28O5/c1-4-5-6-7-14-13(15(12(2)18)16(19)20-3)8-9-17(14)21-10-11-22-17/h13-15H,4-11H2,1-3H3 |
| InChIKey | VGOOYRWCCRYWOL-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|