C16H28O7 — CID 560016
methyl 2-[4-(2-methoxyethoxymethoxy)-2-(2-methyl-1,3-dioxolan-2-yl)cyclopentyl]acetate (PubChem CID 560016) has the molecular formula C16H28O7 and a molecular weight of 332.39 g/mol. Its IUPAC name is methyl 2-[4-(2-methoxyethoxymethoxy)-2-(2-methyl-1,3-dioxolan-2-yl)cyclopentyl]acetate.
| Compound Name | methyl 2-[4-(2-methoxyethoxymethoxy)-2-(2-methyl-1,3-dioxolan-2-yl)cyclopentyl]acetate |
|---|---|
| PubChem CID | 560016 |
| Molecular Formula | C16H28O7 |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | methyl 2-[4-(2-methoxyethoxymethoxy)-2-(2-methyl-1,3-dioxolan-2-yl)cyclopentyl]acetate |
| SMILES | COCCOCOC1CC(CC(=O)OC)C(C2(C)OCCO2)C1 |
| InChI | InChI=1S/C16H28O7/c1-16(22-6-7-23-16)14-10-13(21-11-20-5-4-18-2)8-12(14)9-15(17)19-3/h12-14H,4-11H2,1-3H3 |
| InChIKey | YETDZCULWNTDGF-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|