C10H16O5 — CID 566262
1,5,5-trimethoxy-3a,4,6,6a-tetrahydro-1H-cyclopenta[c]furan-3-one (PubChem CID 566262) has the molecular formula C10H16O5 and a molecular weight of 216.23 g/mol. Its IUPAC name is 1,5,5-trimethoxy-3a,4,6,6a-tetrahydro-1H-cyclopenta[c]furan-3-one.
| Compound Name | 1,5,5-trimethoxy-3a,4,6,6a-tetrahydro-1H-cyclopenta[c]furan-3-one |
|---|---|
| PubChem CID | 566262 |
| Molecular Formula | C10H16O5 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 1,5,5-trimethoxy-3a,4,6,6a-tetrahydro-1H-cyclopenta[c]furan-3-one |
| SMILES | COC1OC(=O)C2CC(OC)(OC)CC12 |
| InChI | InChI=1S/C10H16O5/c1-12-9-7-5-10(13-2,14-3)4-6(7)8(11)15-9/h6-7,9H,4-5H2,1-3H3 |
| InChIKey | XFMFBOIYELUVER-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|