2-(4,5-dimethoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetic acid

C11H14O4 — CID 139765864

IUPAC2-(4,5-dimethoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetic acid
SMILESC=C1C(OC)=C(OC)C=CC1CC(=O)O
InChIInChI=1S/C11H14O4/c1-7-8(6-10(12)13)4-5-9(14-2)11(7)15-3/h4-5,8H,1,6H2,2-3H3,(H,12,13)
InChIKeyGIJQYPZBNAUVDP-UHFFFAOYSA-N
MW210.23 g/mol
LogP1.71
Rot. Bonds4

About 2-(4,5-dimethoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetic acid

2-(4,5-dimethoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetic acid (PubChem CID 139765864) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is 2-(4,5-dimethoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetic acid.

Molecular Properties

Compound Name2-(4,5-dimethoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetic acid
PubChem CID139765864
Molecular FormulaC11H14O4
Molecular Weight210.23 g/mol
Exact Mass210.09
IUPAC Name2-(4,5-dimethoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetic acid
SMILESC=C1C(OC)=C(OC)C=CC1CC(=O)O
InChIInChI=1S/C11H14O4/c1-7-8(6-10(12)13)4-5-9(14-2)11(7)15-3/h4-5,8H,1,6H2,2-3H3,(H,12,13)
InChIKeyGIJQYPZBNAUVDP-UHFFFAOYSA-N
XLogP1.71
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.23
LogP ≤ 51.71
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(4,5-dimethoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4,5-dimethoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetic acid?
The IUPAC name of 2-(4,5-dimethoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetic acid (CID 139765864) is 2-(4,5-dimethoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetic acid.
What is the SMILES notation for 2-(4,5-dimethoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetic acid?
The canonical SMILES for 2-(4,5-dimethoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetic acid is C=C1C(OC)=C(OC)C=CC1CC(=O)O.
What is the InChIKey of 2-(4,5-dimethoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetic acid?
The InChIKey is GIJQYPZBNAUVDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O4/c1-7-8(6-10(12)13)4-5-9(14-2)11(7)15-3/h4-5,8H,1,6H2,2-3H3,(H,12,13).
What are the key properties of 2-(4,5-dimethoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetic acid?
2-(4,5-dimethoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetic acid has a molecular weight of 210.23 g/mol, XLogP of 1.71, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dimethoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetic acid is sourced from PubChem (CID 139765864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).