C18H13F3N4OS — CID 139767301
2-benzylsulfanyl-6-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxypyridine-4-carbonitrile (PubChem CID 139767301) has the molecular formula C18H13F3N4OS and a molecular weight of 390.39 g/mol. Its IUPAC name is 2-benzylsulfanyl-6-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxypyridine-4-carbonitrile.
| Compound Name | 2-benzylsulfanyl-6-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxypyridine-4-carbonitrile |
|---|---|
| PubChem CID | 139767301 |
| Molecular Formula | C18H13F3N4OS |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | 2-benzylsulfanyl-6-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxypyridine-4-carbonitrile |
| SMILES | Cn1nc(C(F)(F)F)cc1Oc1cc(C#N)cc(SCc2ccccc2)n1 |
| InChI | InChI=1S/C18H13F3N4OS/c1-25-17(9-14(24-25)18(19,20)21)26-15-7-13(10-22)8-16(23-15)27-11-12-5-3-2-4-6-12/h2-9H,11H2,1H3 |
| InChIKey | IVRNQWUNQKEKHN-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 63.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |