C10H9F3N4O — CID 19436808
5-methyl-3-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxypyridazine (PubChem CID 19436808) has the molecular formula C10H9F3N4O and a molecular weight of 258.20 g/mol. Its IUPAC name is 5-methyl-3-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxypyridazine.
| Compound Name | 5-methyl-3-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxypyridazine |
|---|---|
| PubChem CID | 19436808 |
| Molecular Formula | C10H9F3N4O |
| Molecular Weight | 258.20 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 5-methyl-3-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxypyridazine |
| SMILES | Cc1cnnc(Oc2cc(C(F)(F)F)nn2C)c1 |
| InChI | InChI=1S/C10H9F3N4O/c1-6-3-8(15-14-5-6)18-9-4-7(10(11,12)13)16-17(9)2/h3-5H,1-2H3 |
| InChIKey | HZUVEUVPLADZSJ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.20 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |