C11H9F5N4O2 — CID 19436809
5-methoxy-3-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-5-yl]oxypyridazine (PubChem CID 19436809) has the molecular formula C11H9F5N4O2 and a molecular weight of 324.21 g/mol. Its IUPAC name is 5-methoxy-3-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-5-yl]oxypyridazine.
| Compound Name | 5-methoxy-3-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-5-yl]oxypyridazine |
|---|---|
| PubChem CID | 19436809 |
| Molecular Formula | C11H9F5N4O2 |
| Molecular Weight | 324.21 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 5-methoxy-3-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-5-yl]oxypyridazine |
| SMILES | COc1cnnc(Oc2cc(C(F)(F)C(F)(F)F)nn2C)c1 |
| InChI | InChI=1S/C11H9F5N4O2/c1-20-9(22-8-3-6(21-2)5-17-18-8)4-7(19-20)10(12,13)11(14,15)16/h3-5H,1-2H3 |
| InChIKey | OIGDVLZXBCLAEI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.21 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|