C11H7F5N2O2 — CID 59389347
7-methoxy-2-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyridine-4-carbaldehyde (PubChem CID 59389347) has the molecular formula C11H7F5N2O2 and a molecular weight of 294.18 g/mol. Its IUPAC name is 7-methoxy-2-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyridine-4-carbaldehyde.
| Compound Name | 7-methoxy-2-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyridine-4-carbaldehyde |
|---|---|
| PubChem CID | 59389347 |
| Molecular Formula | C11H7F5N2O2 |
| Molecular Weight | 294.18 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 7-methoxy-2-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyridine-4-carbaldehyde |
| SMILES | COc1ccc(C=O)c2cc(C(F)(F)C(F)(F)F)nn12 |
| InChI | InChI=1S/C11H7F5N2O2/c1-20-9-3-2-6(5-19)7-4-8(17-18(7)9)10(12,13)11(14,15)16/h2-5H,1H3 |
| InChIKey | VPBDQDLZSQTFRK-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.18 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|