C9H7IN2OS — CID 59389419
7-iodo-2-methylsulfanylpyrazolo[1,5-a]pyridine-4-carbaldehyde (PubChem CID 59389419) has the molecular formula C9H7IN2OS and a molecular weight of 318.14 g/mol. Its IUPAC name is 7-iodo-2-methylsulfanylpyrazolo[1,5-a]pyridine-4-carbaldehyde.
| Compound Name | 7-iodo-2-methylsulfanylpyrazolo[1,5-a]pyridine-4-carbaldehyde |
|---|---|
| PubChem CID | 59389419 |
| Molecular Formula | C9H7IN2OS |
| Molecular Weight | 318.14 g/mol |
| Exact Mass | 317.93 |
| IUPAC Name | 7-iodo-2-methylsulfanylpyrazolo[1,5-a]pyridine-4-carbaldehyde |
| SMILES | CSc1cc2c(C=O)ccc(I)n2n1 |
| InChI | InChI=1S/C9H7IN2OS/c1-14-9-4-7-6(5-13)2-3-8(10)12(7)11-9/h2-5H,1H3 |
| InChIKey | BAAWGGGKVUQOMY-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.14 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|