C15H16F3N3O3 — CID 87495431
tert-butyl 2-[[4-formyl-2-(trifluoromethyl)pyrazolo[1,5-a]pyridin-7-yl]amino]acetate (PubChem CID 87495431) has the molecular formula C15H16F3N3O3 and a molecular weight of 343.31 g/mol. Its IUPAC name is tert-butyl 2-[[4-formyl-2-(trifluoromethyl)pyrazolo[1,5-a]pyridin-7-yl]amino]acetate.
| Compound Name | tert-butyl 2-[[4-formyl-2-(trifluoromethyl)pyrazolo[1,5-a]pyridin-7-yl]amino]acetate |
|---|---|
| PubChem CID | 87495431 |
| Molecular Formula | C15H16F3N3O3 |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | tert-butyl 2-[[4-formyl-2-(trifluoromethyl)pyrazolo[1,5-a]pyridin-7-yl]amino]acetate |
| SMILES | CC(C)(C)OC(=O)CNc1ccc(C=O)c2cc(C(F)(F)F)nn12 |
| InChI | InChI=1S/C15H16F3N3O3/c1-14(2,3)24-13(23)7-19-12-5-4-9(8-22)10-6-11(15(16,17)18)20-21(10)12/h4-6,8,19H,7H2,1-3H3 |
| InChIKey | OGWATHFZSVFIEO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|