C23H29N3O3 — CID 139767867
4-[2-methyl-1-oxo-1-(phenylmethoxyamino)propan-2-yl]-N-pyridin-4-ylcyclohexane-1-carboxamide (PubChem CID 139767867) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is 4-[2-methyl-1-oxo-1-(phenylmethoxyamino)propan-2-yl]-N-pyridin-4-ylcyclohexane-1-carboxamide.
| Compound Name | 4-[2-methyl-1-oxo-1-(phenylmethoxyamino)propan-2-yl]-N-pyridin-4-ylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 139767867 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | 4-[2-methyl-1-oxo-1-(phenylmethoxyamino)propan-2-yl]-N-pyridin-4-ylcyclohexane-1-carboxamide |
| SMILES | CC(C)(C(=O)NOCc1ccccc1)C1CCC(C(=O)Nc2ccncc2)CC1 |
| InChI | InChI=1S/C23H29N3O3/c1-23(2,22(28)26-29-16-17-6-4-3-5-7-17)19-10-8-18(9-11-19)21(27)25-20-12-14-24-15-13-20/h3-7,12-15,18-19H,8-11,16H2,1-2H3,(H,26,28)(H,24,25,27) |
| InChIKey | IPOGJTWLZSAEBR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|