C23H30ClN3O3 — CID 70056751
benzyl N-[2-[4-(pyridin-4-ylcarbamoyl)cyclohexyl]propan-2-yl]carbamate;hydrochloride (PubChem CID 70056751) has the molecular formula C23H30ClN3O3 and a molecular weight of 431.96 g/mol. Its IUPAC name is benzyl N-[2-[4-(pyridin-4-ylcarbamoyl)cyclohexyl]propan-2-yl]carbamate;hydrochloride.
| Compound Name | benzyl N-[2-[4-(pyridin-4-ylcarbamoyl)cyclohexyl]propan-2-yl]carbamate;hydrochloride |
|---|---|
| PubChem CID | 70056751 |
| Molecular Formula | C23H30ClN3O3 |
| Molecular Weight | 431.96 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | benzyl N-[2-[4-(pyridin-4-ylcarbamoyl)cyclohexyl]propan-2-yl]carbamate;hydrochloride |
| SMILES | CC(C)(NC(=O)OCc1ccccc1)C1CCC(C(=O)Nc2ccncc2)CC1.Cl |
| InChI | InChI=1S/C23H29N3O3.ClH/c1-23(2,26-22(28)29-16-17-6-4-3-5-7-17)19-10-8-18(9-11-19)21(27)25-20-12-14-24-15-13-20;/h3-7,12-15,18-19H,8-11,16H2,1-2H3,(H,26,28)(H,24,25,27);1H |
| InChIKey | FMIMXPHKNOJRCU-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.96 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |