C22H32N2O2 — CID 139768522
4-[4-amino-3-(2,2-dimethylpropoxy)phenyl]-2-(2,2-dimethylpropoxy)aniline (PubChem CID 139768522) has the molecular formula C22H32N2O2 and a molecular weight of 356.51 g/mol. Its IUPAC name is 4-[4-amino-3-(2,2-dimethylpropoxy)phenyl]-2-(2,2-dimethylpropoxy)aniline.
| Compound Name | 4-[4-amino-3-(2,2-dimethylpropoxy)phenyl]-2-(2,2-dimethylpropoxy)aniline |
|---|---|
| PubChem CID | 139768522 |
| Molecular Formula | C22H32N2O2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | 4-[4-amino-3-(2,2-dimethylpropoxy)phenyl]-2-(2,2-dimethylpropoxy)aniline |
| SMILES | CC(C)(C)COc1cc(-c2ccc(N)c(OCC(C)(C)C)c2)ccc1N |
| InChI | InChI=1S/C22H32N2O2/c1-21(2,3)13-25-19-11-15(7-9-17(19)23)16-8-10-18(24)20(12-16)26-14-22(4,5)6/h7-12H,13-14,23-24H2,1-6H3 |
| InChIKey | DOKOAUTUZIESFN-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|