About 4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;benzene
4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;benzene (PubChem CID 157477717) has the molecular formula C20H22N2O2
and a molecular weight of 322.41 g/mol. Its IUPAC name is 4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;benzene.
Molecular Properties
| Compound Name | 4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;benzene |
| PubChem CID | 157477717 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;benzene |
| SMILES | COc1cc(-c2ccc(N)c(OC)c2)ccc1N.c1ccccc1 |
| InChI | InChI=1S/C14H16N2O2.C6H6/c1-17-13-7-9(3-5-11(13)15)10-4-6-12(16)14(8-10)18-2;1-2-4-6-5-3-1/h3-8H,15-16H2,1-2H3;1-6H |
| InChIKey | BVUGVABZFPUCSW-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;benzene?
The IUPAC name of 4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;benzene (CID 157477717) is 4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;benzene.
What is the SMILES notation for 4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;benzene?
The canonical SMILES for 4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;benzene is COc1cc(-c2ccc(N)c(OC)c2)ccc1N.c1ccccc1.
What is the InChIKey of 4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;benzene?
The InChIKey is BVUGVABZFPUCSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O2.C6H6/c1-17-13-7-9(3-5-11(13)15)10-4-6-12(16)14(8-10)18-2;1-2-4-6-5-3-1/h3-8H,15-16H2,1-2H3;1-6H.
What are the key properties of 4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;benzene?
4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;benzene has a molecular weight of 322.41 g/mol, XLogP of 4.22, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;benzene is sourced from PubChem (CID 157477717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).