C25H29N3O5 — CID 21329642
4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;2-methoxy-3-oxo-N-phenylbutanamide (PubChem CID 21329642) has the molecular formula C25H29N3O5 and a molecular weight of 451.52 g/mol. Its IUPAC name is 4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;2-methoxy-3-oxo-N-phenylbutanamide.
| Compound Name | 4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;2-methoxy-3-oxo-N-phenylbutanamide |
|---|---|
| PubChem CID | 21329642 |
| Molecular Formula | C25H29N3O5 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;2-methoxy-3-oxo-N-phenylbutanamide |
| SMILES | COC(C(C)=O)C(=O)Nc1ccccc1.COc1cc(-c2ccc(N)c(OC)c2)ccc1N |
| InChI | InChI=1S/C14H16N2O2.C11H13NO3/c1-17-13-7-9(3-5-11(13)15)10-4-6-12(16)14(8-10)18-2;1-8(13)10(15-2)11(14)12-9-6-4-3-5-7-9/h3-8H,15-16H2,1-2H3;3-7,10H,1-2H3,(H,12,14) |
| InChIKey | GTNRIZZEBYPUGJ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 125.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|