About CID 123653070
CID 123653070 (PubChem CID 123653070) has the molecular formula C7H8BNO
and a molecular weight of 132.96 g/mol.
Molecular Properties
| Compound Name | CID 123653070 |
| PubChem CID | 123653070 |
| Molecular Formula | C7H8BNO |
| Molecular Weight | 132.96 g/mol |
| Exact Mass | 133.07 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(N)c(OC)c1 |
| InChI | InChI=1S/C7H8BNO/c1-10-7-4-5(8)2-3-6(7)9/h2-4H,9H2,1H3 |
| InChIKey | HQAAJJUPAWQQJI-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.96 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 123653070 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 123653070?
The IUPAC name of CID 123653070 (CID 123653070) is not available.
What is the SMILES notation for CID 123653070?
The canonical SMILES for CID 123653070 is [B]c1ccc(N)c(OC)c1.
What is the InChIKey of CID 123653070?
The InChIKey is HQAAJJUPAWQQJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8BNO/c1-10-7-4-5(8)2-3-6(7)9/h2-4H,9H2,1H3.
What are the key properties of CID 123653070?
CID 123653070 has a molecular weight of 132.96 g/mol, XLogP of 0.07, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 123653070 is sourced from PubChem (CID 123653070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).