About 4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;5H-tetrazole
4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;5H-tetrazole (PubChem CID 175609219) has the molecular formula C15H18N6O2
and a molecular weight of 314.35 g/mol. Its IUPAC name is 4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;5H-tetrazole.
Molecular Properties
| Compound Name | 4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;5H-tetrazole |
| PubChem CID | 175609219 |
| Molecular Formula | C15H18N6O2 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;5H-tetrazole |
| SMILES | C1N=NN=N1.COc1cc(-c2ccc(N)c(OC)c2)ccc1N |
| InChI | InChI=1S/C14H16N2O2.CH2N4/c1-17-13-7-9(3-5-11(13)15)10-4-6-12(16)14(8-10)18-2;1-2-4-5-3-1/h3-8H,15-16H2,1-2H3;1H2 |
| InChIKey | BRBJQTMXEQGVBN-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 119.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;5H-tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;5H-tetrazole?
The IUPAC name of 4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;5H-tetrazole (CID 175609219) is 4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;5H-tetrazole.
What is the SMILES notation for 4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;5H-tetrazole?
The canonical SMILES for 4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;5H-tetrazole is C1N=NN=N1.COc1cc(-c2ccc(N)c(OC)c2)ccc1N.
What is the InChIKey of 4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;5H-tetrazole?
The InChIKey is BRBJQTMXEQGVBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O2.CH2N4/c1-17-13-7-9(3-5-11(13)15)10-4-6-12(16)14(8-10)18-2;1-2-4-5-3-1/h3-8H,15-16H2,1-2H3;1H2.
What are the key properties of 4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;5H-tetrazole?
4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;5H-tetrazole has a molecular weight of 314.35 g/mol, XLogP of 3.31, 3 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;5H-tetrazole is sourced from PubChem (CID 175609219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).