C10H13N3O2 — CID 142742086
4-(5,6-dihydro-2H-1,2,4-oxadiazin-3-yl)-2-methoxyaniline (PubChem CID 142742086) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is 4-(5,6-dihydro-2H-1,2,4-oxadiazin-3-yl)-2-methoxyaniline.
| Compound Name | 4-(5,6-dihydro-2H-1,2,4-oxadiazin-3-yl)-2-methoxyaniline |
|---|---|
| PubChem CID | 142742086 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 4-(5,6-dihydro-2H-1,2,4-oxadiazin-3-yl)-2-methoxyaniline |
| SMILES | COc1cc(C2=NCCON2)ccc1N |
| InChI | InChI=1S/C10H13N3O2/c1-14-9-6-7(2-3-8(9)11)10-12-4-5-15-13-10/h2-3,6H,4-5,11H2,1H3,(H,12,13) |
| InChIKey | RZCFVDKSKQUVEK-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|