C13H18N2O2 — CID 82243218
2-(4-ethoxy-3-methoxyphenyl)-1,4,5,6-tetrahydropyrimidine (PubChem CID 82243218) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 2-(4-ethoxy-3-methoxyphenyl)-1,4,5,6-tetrahydropyrimidine.
| Compound Name | 2-(4-ethoxy-3-methoxyphenyl)-1,4,5,6-tetrahydropyrimidine |
|---|---|
| PubChem CID | 82243218 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 2-(4-ethoxy-3-methoxyphenyl)-1,4,5,6-tetrahydropyrimidine |
| SMILES | CCOc1ccc(C2=NCCCN2)cc1OC |
| InChI | InChI=1S/C13H18N2O2/c1-3-17-11-6-5-10(9-12(11)16-2)13-14-7-4-8-15-13/h5-6,9H,3-4,7-8H2,1-2H3,(H,14,15) |
| InChIKey | ICTTXIPDNGHMNM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |