C11H14N2O2 — CID 136822415
4-(4,5-dihydro-1H-imidazol-2-yl)-2-ethoxyphenol (PubChem CID 136822415) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is 4-(4,5-dihydro-1H-imidazol-2-yl)-2-ethoxyphenol.
| Compound Name | 4-(4,5-dihydro-1H-imidazol-2-yl)-2-ethoxyphenol |
|---|---|
| PubChem CID | 136822415 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 4-(4,5-dihydro-1H-imidazol-2-yl)-2-ethoxyphenol |
| SMILES | CCOc1cc(C2=NCCN2)ccc1O |
| InChI | InChI=1S/C11H14N2O2/c1-2-15-10-7-8(3-4-9(10)14)11-12-5-6-13-11/h3-4,7,14H,2,5-6H2,1H3,(H,12,13) |
| InChIKey | UFKSTKGLPXWSNI-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |