C18H16N2O4S — CID 10808175
6-(4,5-dihydro-1H-imidazol-2-yl)-2-ethoxy-10,10-dioxothioxanthen-9-one (PubChem CID 10808175) has the molecular formula C18H16N2O4S and a molecular weight of 356.40 g/mol. Its IUPAC name is 6-(4,5-dihydro-1H-imidazol-2-yl)-2-ethoxy-10,10-dioxothioxanthen-9-one.
| Compound Name | 6-(4,5-dihydro-1H-imidazol-2-yl)-2-ethoxy-10,10-dioxothioxanthen-9-one |
|---|---|
| PubChem CID | 10808175 |
| Molecular Formula | C18H16N2O4S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 6-(4,5-dihydro-1H-imidazol-2-yl)-2-ethoxy-10,10-dioxothioxanthen-9-one |
| SMILES | CCOc1ccc2c(c1)C(=O)c1ccc(C3=NCCN3)cc1S2(=O)=O |
| InChI | InChI=1S/C18H16N2O4S/c1-2-24-12-4-6-15-14(10-12)17(21)13-5-3-11(18-19-7-8-20-18)9-16(13)25(15,22)23/h3-6,9-10H,2,7-8H2,1H3,(H,19,20) |
| InChIKey | SBCKSUSKXKZAGT-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |