C19H20N2O5S — CID 10524328
methyl N-(2-aminoethyl)-7-ethoxy-9,10,10-trioxothioxanthene-3-carboximidate (PubChem CID 10524328) has the molecular formula C19H20N2O5S and a molecular weight of 388.45 g/mol. Its IUPAC name is methyl N-(2-aminoethyl)-7-ethoxy-9,10,10-trioxothioxanthene-3-carboximidate.
| Compound Name | methyl N-(2-aminoethyl)-7-ethoxy-9,10,10-trioxothioxanthene-3-carboximidate |
|---|---|
| PubChem CID | 10524328 |
| Molecular Formula | C19H20N2O5S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | methyl N-(2-aminoethyl)-7-ethoxy-9,10,10-trioxothioxanthene-3-carboximidate |
| SMILES | CCOc1ccc2c(c1)C(=O)c1ccc(/C(=N/CCN)OC)cc1S2(=O)=O |
| InChI | InChI=1S/C19H20N2O5S/c1-3-26-13-5-7-16-15(11-13)18(22)14-6-4-12(10-17(14)27(16,23)24)19(25-2)21-9-8-20/h4-7,10-11H,3,8-9,20H2,1-2H3/b21-19- |
| InChIKey | CXMQAEWNERGHAD-VZCXRCSSSA-N |
| XLogP | 1.81 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|