C16H34N4O — CID 139768655
1-[2-[2-(2,2-dimethylpiperazin-1-yl)ethoxy]ethyl]-2,2-dimethylpiperazine (PubChem CID 139768655) has the molecular formula C16H34N4O and a molecular weight of 298.48 g/mol. Its IUPAC name is 1-[2-[2-(2,2-dimethylpiperazin-1-yl)ethoxy]ethyl]-2,2-dimethylpiperazine.
| Compound Name | 1-[2-[2-(2,2-dimethylpiperazin-1-yl)ethoxy]ethyl]-2,2-dimethylpiperazine |
|---|---|
| PubChem CID | 139768655 |
| Molecular Formula | C16H34N4O |
| Molecular Weight | 298.48 g/mol |
| Exact Mass | 298.27 |
| IUPAC Name | 1-[2-[2-(2,2-dimethylpiperazin-1-yl)ethoxy]ethyl]-2,2-dimethylpiperazine |
| SMILES | CC1(C)CNCCN1CCOCCN1CCNCC1(C)C |
| InChI | InChI=1S/C16H34N4O/c1-15(2)13-17-5-7-19(15)9-11-21-12-10-20-8-6-18-14-16(20,3)4/h17-18H,5-14H2,1-4H3 |
| InChIKey | QIWHABCSVXCIAL-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 39.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.48 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|