C9H20N2O — CID 64833037
1-(2-methoxyethyl)-3,3-dimethylpiperazine (PubChem CID 64833037) has the molecular formula C9H20N2O and a molecular weight of 172.27 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-3,3-dimethylpiperazine.
| Compound Name | 1-(2-methoxyethyl)-3,3-dimethylpiperazine |
|---|---|
| PubChem CID | 64833037 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | 1-(2-methoxyethyl)-3,3-dimethylpiperazine |
| SMILES | COCCN1CCNC(C)(C)C1 |
| InChI | InChI=1S/C9H20N2O/c1-9(2)8-11(5-4-10-9)6-7-12-3/h10H,4-8H2,1-3H3 |
| InChIKey | WABUYNGRIUGNEG-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |