C20H42N4O — CID 139768660
1-[2-[2-(2,2-diethylpiperazin-1-yl)ethoxy]ethyl]-2,2-diethylpiperazine (PubChem CID 139768660) has the molecular formula C20H42N4O and a molecular weight of 354.58 g/mol. Its IUPAC name is 1-[2-[2-(2,2-diethylpiperazin-1-yl)ethoxy]ethyl]-2,2-diethylpiperazine.
| Compound Name | 1-[2-[2-(2,2-diethylpiperazin-1-yl)ethoxy]ethyl]-2,2-diethylpiperazine |
|---|---|
| PubChem CID | 139768660 |
| Molecular Formula | C20H42N4O |
| Molecular Weight | 354.58 g/mol |
| Exact Mass | 354.34 |
| IUPAC Name | 1-[2-[2-(2,2-diethylpiperazin-1-yl)ethoxy]ethyl]-2,2-diethylpiperazine |
| SMILES | CCC1(CC)CNCCN1CCOCCN1CCNCC1(CC)CC |
| InChI | InChI=1S/C20H42N4O/c1-5-19(6-2)17-21-9-11-23(19)13-15-25-16-14-24-12-10-22-18-20(24,7-3)8-4/h21-22H,5-18H2,1-4H3 |
| InChIKey | JAVSLBMGCPRYMA-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 39.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.58 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|