C21H21N5O5 — CID 1397734
3,4,5-trimethoxy-N-[(7R)-5-oxo-7-phenyl-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]benzamide (PubChem CID 1397734) has the molecular formula C21H21N5O5 and a molecular weight of 423.43 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[(7R)-5-oxo-7-phenyl-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[(7R)-5-oxo-7-phenyl-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]benzamide |
|---|---|
| PubChem CID | 1397734 |
| Molecular Formula | C21H21N5O5 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 3,4,5-trimethoxy-N-[(7R)-5-oxo-7-phenyl-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]benzamide |
| SMILES | COc1cc(C(=O)Nc2nc3n(n2)[C@@H](c2ccccc2)CC(=O)N3)cc(OC)c1OC |
| InChI | InChI=1S/C21H21N5O5/c1-29-15-9-13(10-16(30-2)18(15)31-3)19(28)23-20-24-21-22-17(27)11-14(26(21)25-20)12-7-5-4-6-8-12/h4-10,14H,11H2,1-3H3,(H2,22,23,24,25,27,28)/t14-/m1/s1 |
| InChIKey | KTRPNIOAUABYQO-CQSZACIVSA-N |
| XLogP | 2.49 |
| TPSA | 116.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |