C21H17N5O4 — CID 1414844
(E)-3-(1,3-benzodioxol-5-yl)-N-[(7R)-5-oxo-7-phenyl-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]prop-2-enamide (PubChem CID 1414844) has the molecular formula C21H17N5O4 and a molecular weight of 403.40 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-N-[(7R)-5-oxo-7-phenyl-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[(7R)-5-oxo-7-phenyl-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 1414844 |
| Molecular Formula | C21H17N5O4 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[(7R)-5-oxo-7-phenyl-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc2c(c1)OCO2)Nc1nc2n(n1)[C@@H](c1ccccc1)CC(=O)N2 |
| InChI | InChI=1S/C21H17N5O4/c27-18(9-7-13-6-8-16-17(10-13)30-12-29-16)22-20-24-21-23-19(28)11-15(26(21)25-20)14-4-2-1-3-5-14/h1-10,15H,11-12H2,(H2,22,23,24,25,27,28)/b9-7+/t15-/m1/s1 |
| InChIKey | IUODLWSNLYCNSE-LOWQCSRCSA-N |
| XLogP | 2.59 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|