C24H29NO3 — CID 139774917
1-[3,5-dimethyl-4-(2-pyrrolidin-1-ylethoxy)phenyl]-3-(3-methoxyphenyl)prop-2-en-1-one (PubChem CID 139774917) has the molecular formula C24H29NO3 and a molecular weight of 379.50 g/mol. Its IUPAC name is 1-[3,5-dimethyl-4-(2-pyrrolidin-1-ylethoxy)phenyl]-3-(3-methoxyphenyl)prop-2-en-1-one.
| Compound Name | 1-[3,5-dimethyl-4-(2-pyrrolidin-1-ylethoxy)phenyl]-3-(3-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 139774917 |
| Molecular Formula | C24H29NO3 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 1-[3,5-dimethyl-4-(2-pyrrolidin-1-ylethoxy)phenyl]-3-(3-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cccc(C=CC(=O)c2cc(C)c(OCCN3CCCC3)c(C)c2)c1 |
| InChI | InChI=1S/C24H29NO3/c1-18-15-21(23(26)10-9-20-7-6-8-22(17-20)27-3)16-19(2)24(18)28-14-13-25-11-4-5-12-25/h6-10,15-17H,4-5,11-14H2,1-3H3 |
| InChIKey | ACXWFYUEVFVSNS-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|