C26H31NO5S — CID 159336033
(1E,4E)-1-(3-ethylphenyl)-5-[3-(2-piperidin-1-ylethoxy)phenyl]penta-1,4-dien-3-one;sulfur trioxide (PubChem CID 159336033) has the molecular formula C26H31NO5S and a molecular weight of 469.60 g/mol. Its IUPAC name is (1E,4E)-1-(3-ethylphenyl)-5-[3-(2-piperidin-1-ylethoxy)phenyl]penta-1,4-dien-3-one;sulfur trioxide.
| Compound Name | (1E,4E)-1-(3-ethylphenyl)-5-[3-(2-piperidin-1-ylethoxy)phenyl]penta-1,4-dien-3-one;sulfur trioxide |
|---|---|
| PubChem CID | 159336033 |
| Molecular Formula | C26H31NO5S |
| Molecular Weight | 469.60 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | (1E,4E)-1-(3-ethylphenyl)-5-[3-(2-piperidin-1-ylethoxy)phenyl]penta-1,4-dien-3-one;sulfur trioxide |
| SMILES | CCc1cccc(/C=C/C(=O)/C=C/c2cccc(OCCN3CCCCC3)c2)c1.O=S(=O)=O |
| InChI | InChI=1S/C26H31NO2.O3S/c1-2-22-8-6-9-23(20-22)12-14-25(28)15-13-24-10-7-11-26(21-24)29-19-18-27-16-4-3-5-17-27;1-4(2)3/h6-15,20-21H,2-5,16-19H2,1H3;/b14-12+,15-13+; |
| InChIKey | LFNVHJNOVWNURA-ZUADHLFUSA-N |
| XLogP | 4.41 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.60 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|