C37H50O3 — CID 139775027
1-[5-decyl-2-[2-(4-phenylphenyl)ethyl]phenoxy]propan-2-yl butanoate (PubChem CID 139775027) has the molecular formula C37H50O3 and a molecular weight of 542.80 g/mol. Its IUPAC name is 1-[5-decyl-2-[2-(4-phenylphenyl)ethyl]phenoxy]propan-2-yl butanoate.
| Compound Name | 1-[5-decyl-2-[2-(4-phenylphenyl)ethyl]phenoxy]propan-2-yl butanoate |
|---|---|
| PubChem CID | 139775027 |
| Molecular Formula | C37H50O3 |
| Molecular Weight | 542.80 g/mol |
| Exact Mass | 542.38 |
| IUPAC Name | 1-[5-decyl-2-[2-(4-phenylphenyl)ethyl]phenoxy]propan-2-yl butanoate |
| SMILES | CCCCCCCCCCc1ccc(CCc2ccc(-c3ccccc3)cc2)c(OCC(C)OC(=O)CCC)c1 |
| InChI | InChI=1S/C37H50O3/c1-4-6-7-8-9-10-11-13-17-32-23-27-35(36(28-32)39-29-30(3)40-37(38)16-5-2)26-22-31-20-24-34(25-21-31)33-18-14-12-15-19-33/h12,14-15,18-21,23-25,27-28,30H,4-11,13,16-17,22,26,29H2,1-3H3 |
| InChIKey | JTQDNBUEAGISIZ-UHFFFAOYSA-N |
| XLogP | 9.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.80 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|