C9H7NS — CID 139776980
(3aZ,7Z,9E)-thieno[3,2-c]azocine (PubChem CID 139776980) has the molecular formula C9H7NS and a molecular weight of 161.23 g/mol. Its IUPAC name is (3aZ,7Z,9E)-thieno[3,2-c]azocine.
| Compound Name | (3aZ,7Z,9E)-thieno[3,2-c]azocine |
|---|---|
| PubChem CID | 139776980 |
| Molecular Formula | C9H7NS |
| Molecular Weight | 161.23 g/mol |
| Exact Mass | 161.03 |
| IUPAC Name | (3aZ,7Z,9E)-thieno[3,2-c]azocine |
| SMILES | C1=C\C=c2\scc\c2=C\N=C/1 |
| InChI | InChI=1S/C9H7NS/c1-2-5-10-7-8-4-6-11-9(8)3-1/h1-7H/b2-1-,3-1-,5-2-,8-7-,9-3+,10-5-,10-7- |
| InChIKey | HZXGDXKNCMYXBX-KOJYUYPSSA-N |
| XLogP | 0.91 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.23 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |