About thiopyrano[2,3-c]azepine
thiopyrano[2,3-c]azepine (PubChem CID 141202666) has the molecular formula C9H7NS
and a molecular weight of 161.23 g/mol. Its IUPAC name is thiopyrano[2,3-c]azepine.
Molecular Properties
| Compound Name | thiopyrano[2,3-c]azepine |
| PubChem CID | 141202666 |
| Molecular Formula | C9H7NS |
| Molecular Weight | 161.23 g/mol |
| Exact Mass | 161.03 |
| IUPAC Name | thiopyrano[2,3-c]azepine |
| SMILES | C1=CSC2=CN=CC=CC2=C1 |
| InChI | InChI=1S/C9H7NS/c1-3-8-4-2-6-11-9(8)7-10-5-1/h1-7H |
| InChIKey | URPNJPGQTZEAPH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.23 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze thiopyrano[2,3-c]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiopyrano[2,3-c]azepine?
The IUPAC name of thiopyrano[2,3-c]azepine (CID 141202666) is thiopyrano[2,3-c]azepine.
What is the SMILES notation for thiopyrano[2,3-c]azepine?
The canonical SMILES for thiopyrano[2,3-c]azepine is C1=CSC2=CN=CC=CC2=C1.
What is the InChIKey of thiopyrano[2,3-c]azepine?
The InChIKey is URPNJPGQTZEAPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NS/c1-3-8-4-2-6-11-9(8)7-10-5-1/h1-7H.
What are the key properties of thiopyrano[2,3-c]azepine?
thiopyrano[2,3-c]azepine has a molecular weight of 161.23 g/mol, XLogP of 2.66, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for thiopyrano[2,3-c]azepine is sourced from PubChem (CID 141202666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).