About 2-(cyclohexen-1-ylmethyl)-1,4-thiazepine
2-(cyclohexen-1-ylmethyl)-1,4-thiazepine (PubChem CID 91268173) has the molecular formula C12H15NS
and a molecular weight of 205.33 g/mol. Its IUPAC name is 2-(cyclohexen-1-ylmethyl)-1,4-thiazepine.
Molecular Properties
| Compound Name | 2-(cyclohexen-1-ylmethyl)-1,4-thiazepine |
| PubChem CID | 91268173 |
| Molecular Formula | C12H15NS |
| Molecular Weight | 205.33 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 2-(cyclohexen-1-ylmethyl)-1,4-thiazepine |
| SMILES | C1=CSC(CC2=CCCCC2)=CN=C1 |
| InChI | InChI=1S/C12H15NS/c1-2-5-11(6-3-1)9-12-10-13-7-4-8-14-12/h4-5,7-8,10H,1-3,6,9H2 |
| InChIKey | WXMANYVEDQXNDK-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.33 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(cyclohexen-1-ylmethyl)-1,4-thiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclohexen-1-ylmethyl)-1,4-thiazepine?
The IUPAC name of 2-(cyclohexen-1-ylmethyl)-1,4-thiazepine (CID 91268173) is 2-(cyclohexen-1-ylmethyl)-1,4-thiazepine.
What is the SMILES notation for 2-(cyclohexen-1-ylmethyl)-1,4-thiazepine?
The canonical SMILES for 2-(cyclohexen-1-ylmethyl)-1,4-thiazepine is C1=CSC(CC2=CCCCC2)=CN=C1.
What is the InChIKey of 2-(cyclohexen-1-ylmethyl)-1,4-thiazepine?
The InChIKey is WXMANYVEDQXNDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NS/c1-2-5-11(6-3-1)9-12-10-13-7-4-8-14-12/h4-5,7-8,10H,1-3,6,9H2.
What are the key properties of 2-(cyclohexen-1-ylmethyl)-1,4-thiazepine?
2-(cyclohexen-1-ylmethyl)-1,4-thiazepine has a molecular weight of 205.33 g/mol, XLogP of 4.05, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclohexen-1-ylmethyl)-1,4-thiazepine is sourced from PubChem (CID 91268173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).