C15H27NS — CID 123854441
N-[(E,3Z)-3-(3-methylsulfanylpropylidene)non-1-enyl]ethanimine (PubChem CID 123854441) has the molecular formula C15H27NS and a molecular weight of 253.45 g/mol. Its IUPAC name is N-[(E,3Z)-3-(3-methylsulfanylpropylidene)non-1-enyl]ethanimine.
| Compound Name | N-[(E,3Z)-3-(3-methylsulfanylpropylidene)non-1-enyl]ethanimine |
|---|---|
| PubChem CID | 123854441 |
| Molecular Formula | C15H27NS |
| Molecular Weight | 253.45 g/mol |
| Exact Mass | 253.19 |
| IUPAC Name | N-[(E,3Z)-3-(3-methylsulfanylpropylidene)non-1-enyl]ethanimine |
| SMILES | C/C=N/C=C/C(=C\CCSC)CCCCCC |
| InChI | InChI=1S/C15H27NS/c1-4-6-7-8-10-15(11-9-14-17-3)12-13-16-5-2/h5,11-13H,4,6-10,14H2,1-3H3/b13-12+,15-11-,16-5+ |
| InChIKey | MQTYMAJJUGCZBI-XPQGATPWSA-N |
| XLogP | 5.24 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.45 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|