C20H31NS — CID 177001395
(2E,3Z)-2,3-bis(prop-2-enylidene)thiophene;ethane;N-[(Z)-prop-1-enyl]prop-2-en-1-imine (PubChem CID 177001395) has the molecular formula C20H31NS and a molecular weight of 317.54 g/mol. Its IUPAC name is (2E,3Z)-2,3-bis(prop-2-enylidene)thiophene;ethane;N-[(Z)-prop-1-enyl]prop-2-en-1-imine.
| Compound Name | (2E,3Z)-2,3-bis(prop-2-enylidene)thiophene;ethane;N-[(Z)-prop-1-enyl]prop-2-en-1-imine |
|---|---|
| PubChem CID | 177001395 |
| Molecular Formula | C20H31NS |
| Molecular Weight | 317.54 g/mol |
| Exact Mass | 317.22 |
| IUPAC Name | (2E,3Z)-2,3-bis(prop-2-enylidene)thiophene;ethane;N-[(Z)-prop-1-enyl]prop-2-en-1-imine |
| SMILES | C=C/C=N/C=C\C.C=C/C=c1/ccs/c1=C/C=C.CC.CC |
| InChI | InChI=1S/C10H10S.C6H9N.2C2H6/c1-3-5-9-7-8-11-10(9)6-4-2;1-3-5-7-6-4-2;2*1-2/h3-8H,1-2H2;3-6H,1H2,2H3;2*1-2H3/b9-5-,10-6+;6-4-,7-5+;; |
| InChIKey | UNXADSXXXSDNOB-YPECLQOZSA-N |
| XLogP | 5.51 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.54 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|