C19H31NS — CID 142177844
ethane;N-ethenyl-1-(6-ethenyl-3a,7a-dihydro-1-benzothiophen-5-yl)methanimine (PubChem CID 142177844) has the molecular formula C19H31NS and a molecular weight of 305.53 g/mol. Its IUPAC name is ethane;N-ethenyl-1-(6-ethenyl-3a,7a-dihydro-1-benzothiophen-5-yl)methanimine.
| Compound Name | ethane;N-ethenyl-1-(6-ethenyl-3a,7a-dihydro-1-benzothiophen-5-yl)methanimine |
|---|---|
| PubChem CID | 142177844 |
| Molecular Formula | C19H31NS |
| Molecular Weight | 305.53 g/mol |
| Exact Mass | 305.22 |
| IUPAC Name | ethane;N-ethenyl-1-(6-ethenyl-3a,7a-dihydro-1-benzothiophen-5-yl)methanimine |
| SMILES | C=C/N=C/C1=CC2C=CSC2C=C1C=C.CC.CC.CC |
| InChI | InChI=1S/C13H13NS.3C2H6/c1-3-10-8-13-11(5-6-15-13)7-12(10)9-14-4-2;3*1-2/h3-9,11,13H,1-2H2;3*1-2H3/b14-9+;;; |
| InChIKey | OVXDZNOTANPJDF-LQFHBUQSSA-N |
| XLogP | 6.58 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.53 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|