C21H37NS — CID 142177842
(Z,2E)-N,3-bis(ethenyl)-2-[(2-methyl-2,3-dihydrothiophen-3-yl)methylidene]pent-3-en-1-imine;ethane (PubChem CID 142177842) has the molecular formula C21H37NS and a molecular weight of 335.60 g/mol. Its IUPAC name is (Z,2E)-N,3-bis(ethenyl)-2-[(2-methyl-2,3-dihydrothiophen-3-yl)methylidene]pent-3-en-1-imine;ethane.
| Compound Name | (Z,2E)-N,3-bis(ethenyl)-2-[(2-methyl-2,3-dihydrothiophen-3-yl)methylidene]pent-3-en-1-imine;ethane |
|---|---|
| PubChem CID | 142177842 |
| Molecular Formula | C21H37NS |
| Molecular Weight | 335.60 g/mol |
| Exact Mass | 335.26 |
| IUPAC Name | (Z,2E)-N,3-bis(ethenyl)-2-[(2-methyl-2,3-dihydrothiophen-3-yl)methylidene]pent-3-en-1-imine;ethane |
| SMILES | C=CN=CC(=CC1C=CSC1C)/C(C=C)=C\C.CC.CC.CC |
| InChI | InChI=1S/C15H19NS.3C2H6/c1-5-13(6-2)15(11-16-7-3)10-14-8-9-17-12(14)4;3*1-2/h5-12,14H,1,3H2,2,4H3;3*1-2H3/b13-6-,15-10-,16-11+;;; |
| InChIKey | YMGSAIHHISFSNN-PUPGYQTESA-N |
| XLogP | 7.60 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.60 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|