C18H23NS — CID 146176633
(4E,5Z)-2-ethenylsulfanyl-N-[(Z)-3-methylbut-1-enyl]-4-prop-2-enylideneocta-1,5,7-trien-3-imine (PubChem CID 146176633) has the molecular formula C18H23NS and a molecular weight of 285.46 g/mol. Its IUPAC name is (4E,5Z)-2-ethenylsulfanyl-N-[(Z)-3-methylbut-1-enyl]-4-prop-2-enylideneocta-1,5,7-trien-3-imine.
| Compound Name | (4E,5Z)-2-ethenylsulfanyl-N-[(Z)-3-methylbut-1-enyl]-4-prop-2-enylideneocta-1,5,7-trien-3-imine |
|---|---|
| PubChem CID | 146176633 |
| Molecular Formula | C18H23NS |
| Molecular Weight | 285.46 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | (4E,5Z)-2-ethenylsulfanyl-N-[(Z)-3-methylbut-1-enyl]-4-prop-2-enylideneocta-1,5,7-trien-3-imine |
| SMILES | C=C/C=C\C(=C/C=C)\C(=N\C=C/C(C)C)C(=C)SC=C |
| InChI | InChI=1S/C18H23NS/c1-7-10-12-17(11-8-2)18(16(6)20-9-3)19-14-13-15(4)5/h7-15H,1-3,6H2,4-5H3/b12-10-,14-13-,17-11+,19-18+ |
| InChIKey | UDWYZPSJSLPASN-WSGYAKBESA-N |
| XLogP | 5.84 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.46 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|