C10H17NS — CID 144752184
(4Z)-N-ethyl-1-methylsulfanylhepta-4,6-dien-3-imine (PubChem CID 144752184) has the molecular formula C10H17NS and a molecular weight of 183.32 g/mol. Its IUPAC name is (4Z)-N-ethyl-1-methylsulfanylhepta-4,6-dien-3-imine.
| Compound Name | (4Z)-N-ethyl-1-methylsulfanylhepta-4,6-dien-3-imine |
|---|---|
| PubChem CID | 144752184 |
| Molecular Formula | C10H17NS |
| Molecular Weight | 183.32 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | (4Z)-N-ethyl-1-methylsulfanylhepta-4,6-dien-3-imine |
| SMILES | C=C/C=C\C(CCSC)=N\CC |
| InChI | InChI=1S/C10H17NS/c1-4-6-7-10(11-5-2)8-9-12-3/h4,6-7H,1,5,8-9H2,2-3H3/b7-6-,11-10- |
| InChIKey | GKNPEXYNOIQRMC-QOXWLJPHSA-N |
| XLogP | 2.94 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|