C11H21NS — CID 123251752
3-[[(E)-oct-5-en-4-ylidene]amino]propane-1-thiol (PubChem CID 123251752) has the molecular formula C11H21NS and a molecular weight of 199.36 g/mol. Its IUPAC name is 3-[[(E)-oct-5-en-4-ylidene]amino]propane-1-thiol.
| Compound Name | 3-[[(E)-oct-5-en-4-ylidene]amino]propane-1-thiol |
|---|---|
| PubChem CID | 123251752 |
| Molecular Formula | C11H21NS |
| Molecular Weight | 199.36 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 3-[[(E)-oct-5-en-4-ylidene]amino]propane-1-thiol |
| SMILES | CC/C=C/C(CCC)=N/CCCS |
| InChI | InChI=1S/C11H21NS/c1-3-5-8-11(7-4-2)12-9-6-10-13/h5,8,13H,3-4,6-7,9-10H2,1-2H3/b8-5+,12-11+ |
| InChIKey | VKGJRLRMFZJARK-CQYWEGEGSA-N |
| XLogP | 3.51 |
| TPSA | 12.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|