C11H17NS2 — CID 163881730
(Z)-3-[1-(2-methyl-2,3-dihydropyridin-6-yl)ethylsulfanyl]prop-2-ene-1-thiol (PubChem CID 163881730) has the molecular formula C11H17NS2 and a molecular weight of 227.40 g/mol. Its IUPAC name is (Z)-3-[1-(2-methyl-2,3-dihydropyridin-6-yl)ethylsulfanyl]prop-2-ene-1-thiol.
| Compound Name | (Z)-3-[1-(2-methyl-2,3-dihydropyridin-6-yl)ethylsulfanyl]prop-2-ene-1-thiol |
|---|---|
| PubChem CID | 163881730 |
| Molecular Formula | C11H17NS2 |
| Molecular Weight | 227.40 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | (Z)-3-[1-(2-methyl-2,3-dihydropyridin-6-yl)ethylsulfanyl]prop-2-ene-1-thiol |
| SMILES | CC1CC=CC(C(C)S/C=C\CS)=N1 |
| InChI | InChI=1S/C11H17NS2/c1-9-5-3-6-11(12-9)10(2)14-8-4-7-13/h3-4,6,8-10,13H,5,7H2,1-2H3/b8-4- |
| InChIKey | PTUOLJRPTFDITF-YWEYNIOJSA-N |
| XLogP | 3.34 |
| TPSA | 12.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|