C15H21NS — CID 139572395
(6E)-N-ethyl-6-(3-propan-2-ylsulfanylbut-3-en-2-ylidene)cyclohexa-2,4-dien-1-imine (PubChem CID 139572395) has the molecular formula C15H21NS and a molecular weight of 247.41 g/mol. Its IUPAC name is (6E)-N-ethyl-6-(3-propan-2-ylsulfanylbut-3-en-2-ylidene)cyclohexa-2,4-dien-1-imine.
| Compound Name | (6E)-N-ethyl-6-(3-propan-2-ylsulfanylbut-3-en-2-ylidene)cyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 139572395 |
| Molecular Formula | C15H21NS |
| Molecular Weight | 247.41 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | (6E)-N-ethyl-6-(3-propan-2-ylsulfanylbut-3-en-2-ylidene)cyclohexa-2,4-dien-1-imine |
| SMILES | C=C(SC(C)C)/C(C)=C1\C=CC=C\C1=N/CC |
| InChI | InChI=1S/C15H21NS/c1-6-16-15-10-8-7-9-14(15)12(4)13(5)17-11(2)3/h7-11H,5-6H2,1-4H3/b14-12+,16-15+ |
| InChIKey | WOUDRIASUHBDSO-QUUOAJEZSA-N |
| XLogP | 4.55 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.41 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|