C13H21NS — CID 91750857
(2R,5R)-4,5-dimethyl-2-[(1E,3E)-octa-1,3-dienyl]-2,5-dihydro-1,3-thiazole (PubChem CID 91750857) has the molecular formula C13H21NS and a molecular weight of 223.38 g/mol. Its IUPAC name is (2R,5R)-4,5-dimethyl-2-[(1E,3E)-octa-1,3-dienyl]-2,5-dihydro-1,3-thiazole.
| Compound Name | (2R,5R)-4,5-dimethyl-2-[(1E,3E)-octa-1,3-dienyl]-2,5-dihydro-1,3-thiazole |
|---|---|
| PubChem CID | 91750857 |
| Molecular Formula | C13H21NS |
| Molecular Weight | 223.38 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | (2R,5R)-4,5-dimethyl-2-[(1E,3E)-octa-1,3-dienyl]-2,5-dihydro-1,3-thiazole |
| SMILES | CCCC/C=C/C=C/[C@@H]1N=C(C)[C@@H](C)S1 |
| InChI | InChI=1S/C13H21NS/c1-4-5-6-7-8-9-10-13-14-11(2)12(3)15-13/h7-10,12-13H,4-6H2,1-3H3/b8-7+,10-9+/t12-,13-/m1/s1 |
| InChIKey | DLSYFVPFFOKHTD-JLXUPIONSA-N |
| XLogP | 4.21 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.38 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|