C13H23NS — CID 91750865
(2R,5S)-4,5-dimethyl-2-[(E)-oct-1-enyl]-2,5-dihydro-1,3-thiazole (PubChem CID 91750865) has the molecular formula C13H23NS and a molecular weight of 225.40 g/mol. Its IUPAC name is (2R,5S)-4,5-dimethyl-2-[(E)-oct-1-enyl]-2,5-dihydro-1,3-thiazole.
| Compound Name | (2R,5S)-4,5-dimethyl-2-[(E)-oct-1-enyl]-2,5-dihydro-1,3-thiazole |
|---|---|
| PubChem CID | 91750865 |
| Molecular Formula | C13H23NS |
| Molecular Weight | 225.40 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | (2R,5S)-4,5-dimethyl-2-[(E)-oct-1-enyl]-2,5-dihydro-1,3-thiazole |
| SMILES | CCCCCC/C=C/[C@@H]1N=C(C)[C@H](C)S1 |
| InChI | InChI=1S/C13H23NS/c1-4-5-6-7-8-9-10-13-14-11(2)12(3)15-13/h9-10,12-13H,4-8H2,1-3H3/b10-9+/t12-,13+/m0/s1 |
| InChIKey | DWHWYFMGINVMJL-CCJARXIYSA-N |
| XLogP | 4.44 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.40 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|