C9H11NS — CID 142249208
8-methyl-6,8-dihydro-2H-thieno[3,4-b]azepine (PubChem CID 142249208) has the molecular formula C9H11NS and a molecular weight of 165.26 g/mol. Its IUPAC name is 8-methyl-6,8-dihydro-2H-thieno[3,4-b]azepine.
| Compound Name | 8-methyl-6,8-dihydro-2H-thieno[3,4-b]azepine |
|---|---|
| PubChem CID | 142249208 |
| Molecular Formula | C9H11NS |
| Molecular Weight | 165.26 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | 8-methyl-6,8-dihydro-2H-thieno[3,4-b]azepine |
| SMILES | CC1SCC2=CC=CCN=C21 |
| InChI | InChI=1S/C9H11NS/c1-7-9-8(6-11-7)4-2-3-5-10-9/h2-4,7H,5-6H2,1H3 |
| InChIKey | DDRXGLUELHAQQL-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.26 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |