C12H17NS — CID 91202018
N-[(2-ethylidene-6-methyl-4,5-dihydrothiepin-3-ylidene)methyl]ethanimine (PubChem CID 91202018) has the molecular formula C12H17NS and a molecular weight of 207.34 g/mol. Its IUPAC name is N-[(2-ethylidene-6-methyl-4,5-dihydrothiepin-3-ylidene)methyl]ethanimine.
| Compound Name | N-[(2-ethylidene-6-methyl-4,5-dihydrothiepin-3-ylidene)methyl]ethanimine |
|---|---|
| PubChem CID | 91202018 |
| Molecular Formula | C12H17NS |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | N-[(2-ethylidene-6-methyl-4,5-dihydrothiepin-3-ylidene)methyl]ethanimine |
| SMILES | CC=C1SC=C(C)CCC1=C/N=C/C |
| InChI | InChI=1S/C12H17NS/c1-4-12-11(8-13-5-2)7-6-10(3)9-14-12/h4-5,8-9H,6-7H2,1-3H3/b11-8?,12-4?,13-5+ |
| InChIKey | KLJIAGZRDROOQI-WDVCXXQASA-N |
| XLogP | 4.30 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|